C9H11Cl2N — CID 143378301
(1Z,2Z,6E)-2,6-dichloro-5,8-dimethyl-4,5-dihydroazocine (PubChem CID 143378301) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is (1Z,2Z,6E)-2,6-dichloro-5,8-dimethyl-4,5-dihydroazocine.
| Compound Name | (1Z,2Z,6E)-2,6-dichloro-5,8-dimethyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 143378301 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | (1Z,2Z,6E)-2,6-dichloro-5,8-dimethyl-4,5-dihydroazocine |
| SMILES | CC1=N/C(Cl)=C\CC(C)/C(Cl)=C\1 |
| InChI | InChI=1S/C9H11Cl2N/c1-6-3-4-9(11)12-7(2)5-8(6)10/h4-6H,3H2,1-2H3/b8-5+,9-4-,12-7- |
| InChIKey | PEHNPHRHNZZFAD-YLYNFKMOSA-N |
| XLogP | 3.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|