C8H8Cl3N — CID 143378539
(1E,2Z,6E)-2,6,8-trichloro-5-methyl-4,5-dihydroazocine (PubChem CID 143378539) has the molecular formula C8H8Cl3N and a molecular weight of 224.52 g/mol. Its IUPAC name is (1E,2Z,6E)-2,6,8-trichloro-5-methyl-4,5-dihydroazocine.
| Compound Name | (1E,2Z,6E)-2,6,8-trichloro-5-methyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 143378539 |
| Molecular Formula | C8H8Cl3N |
| Molecular Weight | 224.52 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | (1E,2Z,6E)-2,6,8-trichloro-5-methyl-4,5-dihydroazocine |
| SMILES | CC1C/C=C(Cl)\N=C(Cl)/C=C\1Cl |
| InChI | InChI=1S/C8H8Cl3N/c1-5-2-3-7(10)12-8(11)4-6(5)9/h3-5H,2H2,1H3/b6-4+,7-3-,12-8+ |
| InChIKey | JTNVRBOPTFOKJX-SVVMDGRLSA-N |
| XLogP | 3.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|