C7H11ClN2 — CID 143378600
5-chloro-4-methyl-3,4-dihydro-2H-azepin-7-amine (PubChem CID 143378600) has the molecular formula C7H11ClN2 and a molecular weight of 158.63 g/mol. Its IUPAC name is 5-chloro-4-methyl-3,4-dihydro-2H-azepin-7-amine.
| Compound Name | 5-chloro-4-methyl-3,4-dihydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 143378600 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-chloro-4-methyl-3,4-dihydro-2H-azepin-7-amine |
| SMILES | CC1CCN=C(N)C=C1Cl |
| InChI | InChI=1S/C7H11ClN2/c1-5-2-3-10-7(9)4-6(5)8/h4-5H,2-3H2,1H3,(H2,9,10) |
| InChIKey | ZACPSSOELXCHAI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |