C10H15N3 — CID 64760327
5,8-dimethyl-5,6,7,8-tetrahydroquinazolin-2-amine (PubChem CID 64760327) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 5,8-dimethyl-5,6,7,8-tetrahydroquinazolin-2-amine.
| Compound Name | 5,8-dimethyl-5,6,7,8-tetrahydroquinazolin-2-amine |
|---|---|
| PubChem CID | 64760327 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 5,8-dimethyl-5,6,7,8-tetrahydroquinazolin-2-amine |
| SMILES | CC1CCC(C)c2nc(N)ncc21 |
| InChI | InChI=1S/C10H15N3/c1-6-3-4-7(2)9-8(6)5-12-10(11)13-9/h5-7H,3-4H2,1-2H3,(H2,11,12,13) |
| InChIKey | GNEGZFZPVALYCO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |