C10H16N4 — CID 23086329
5-cyclohexylpyrimidine-2,4-diamine (PubChem CID 23086329) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 5-cyclohexylpyrimidine-2,4-diamine.
| Compound Name | 5-cyclohexylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 23086329 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 5-cyclohexylpyrimidine-2,4-diamine |
| SMILES | Nc1ncc(C2CCCCC2)c(N)n1 |
| InChI | InChI=1S/C10H16N4/c11-9-8(6-13-10(12)14-9)7-4-2-1-3-5-7/h6-7H,1-5H2,(H4,11,12,13,14) |
| InChIKey | GOWAESRMEPHYEK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |