C21H28O7 — CID 143379286
[3-(2-hydroxy-2-methylpropoxy)-3-methylbutyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 143379286) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is [3-(2-hydroxy-2-methylpropoxy)-3-methylbutyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | [3-(2-hydroxy-2-methylpropoxy)-3-methylbutyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 143379286 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | [3-(2-hydroxy-2-methylpropoxy)-3-methylbutyl] 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)OCCC(C)(C)OCC(C)(C)O)ccc12 |
| InChI | InChI=1S/C21H28O7/c1-14-10-18(22)28-17-11-15(6-7-16(14)17)26-12-19(23)25-9-8-21(4,5)27-13-20(2,3)24/h6-7,10-11,24H,8-9,12-13H2,1-5H3 |
| InChIKey | BUGKISKKRMAYIO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|