C26H47NO3 — CID 143379335
(3S,5S)-6-[(2R,3S,4S,7S,8S,11E)-3,7-dihydroxy-4,8,14-trimethylpentadeca-11,13-dien-2-yl]-3-ethyl-5-methylpiperidin-2-one (PubChem CID 143379335) has the molecular formula C26H47NO3 and a molecular weight of 421.67 g/mol. Its IUPAC name is (3S,5S)-6-[(2R,3S,4S,7S,8S,11E)-3,7-dihydroxy-4,8,14-trimethylpentadeca-11,13-dien-2-yl]-3-ethyl-5-methylpiperidin-2-one.
| Compound Name | (3S,5S)-6-[(2R,3S,4S,7S,8S,11E)-3,7-dihydroxy-4,8,14-trimethylpentadeca-11,13-dien-2-yl]-3-ethyl-5-methylpiperidin-2-one |
|---|---|
| PubChem CID | 143379335 |
| Molecular Formula | C26H47NO3 |
| Molecular Weight | 421.67 g/mol |
| Exact Mass | 421.36 |
| IUPAC Name | (3S,5S)-6-[(2R,3S,4S,7S,8S,11E)-3,7-dihydroxy-4,8,14-trimethylpentadeca-11,13-dien-2-yl]-3-ethyl-5-methylpiperidin-2-one |
| SMILES | CC[C@H]1C[C@H](C)C([C@@H](C)[C@@H](O)[C@@H](C)CC[C@H](O)[C@@H](C)CC/C=C/C=C(C)C)NC1=O |
| InChI | InChI=1S/C26H47NO3/c1-8-22-16-20(6)24(27-26(22)30)21(7)25(29)19(5)14-15-23(28)18(4)13-11-9-10-12-17(2)3/h9-10,12,18-25,28-29H,8,11,13-16H2,1-7H3,(H,27,30)/b10-9+/t18-,19-,20-,21+,22-,23-,24?,25-/m0/s1 |
| InChIKey | JFNFUWALSKMSRR-HVOAQDOJSA-N |
| XLogP | 5.25 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|