C21H34F3NO — CID 143379493
2-methyl-N-propylpropan-1-amine;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]pentan-1-one (PubChem CID 143379493) has the molecular formula C21H34F3NO and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-methyl-N-propylpropan-1-amine;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]pentan-1-one.
| Compound Name | 2-methyl-N-propylpropan-1-amine;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]pentan-1-one |
|---|---|
| PubChem CID | 143379493 |
| Molecular Formula | C21H34F3NO |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 2-methyl-N-propylpropan-1-amine;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1ccc(C(C)C(F)(F)F)cc1.CCCNCC(C)C |
| InChI | InChI=1S/C14H17F3O.C7H17N/c1-3-4-5-13(18)12-8-6-11(7-9-12)10(2)14(15,16)17;1-4-5-8-6-7(2)3/h6-10H,3-5H2,1-2H3;7-8H,4-6H2,1-3H3 |
| InChIKey | ZUAPMFSYCUYTHM-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|