C18H13Cl2N3O — CID 143380111
N-[[5-(2-chlorophenyl)-4-(4-chlorophenyl)-2-pyridinyl]amino]formamide (PubChem CID 143380111) has the molecular formula C18H13Cl2N3O and a molecular weight of 358.23 g/mol. Its IUPAC name is N-[[5-(2-chlorophenyl)-4-(4-chlorophenyl)-2-pyridinyl]amino]formamide.
| Compound Name | N-[[5-(2-chlorophenyl)-4-(4-chlorophenyl)-2-pyridinyl]amino]formamide |
|---|---|
| PubChem CID | 143380111 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | N-[[5-(2-chlorophenyl)-4-(4-chlorophenyl)-2-pyridinyl]amino]formamide |
| SMILES | O=CNNc1cc(-c2ccc(Cl)cc2)c(-c2ccccc2Cl)cn1 |
| InChI | InChI=1S/C18H13Cl2N3O/c19-13-7-5-12(6-8-13)15-9-18(23-22-11-24)21-10-16(15)14-3-1-2-4-17(14)20/h1-11H,(H,21,23)(H,22,24) |
| InChIKey | VLEVZCSDQRUZAE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|