C21H41NO2 — CID 143380203
(4Z,6Z)-6-[2-(2-aminocyclohexyl)oxyethyl]octa-4,6-dien-2-yn-4-ol;ethane;methane (PubChem CID 143380203) has the molecular formula C21H41NO2 and a molecular weight of 339.56 g/mol. Its IUPAC name is (4Z,6Z)-6-[2-(2-aminocyclohexyl)oxyethyl]octa-4,6-dien-2-yn-4-ol;ethane;methane.
| Compound Name | (4Z,6Z)-6-[2-(2-aminocyclohexyl)oxyethyl]octa-4,6-dien-2-yn-4-ol;ethane;methane |
|---|---|
| PubChem CID | 143380203 |
| Molecular Formula | C21H41NO2 |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.31 |
| IUPAC Name | (4Z,6Z)-6-[2-(2-aminocyclohexyl)oxyethyl]octa-4,6-dien-2-yn-4-ol;ethane;methane |
| SMILES | C.CC.CC.CC#C/C(O)=C/C(=C\C)CCOC1CCCCC1N |
| InChI | InChI=1S/C16H25NO2.2C2H6.CH4/c1-3-7-14(18)12-13(4-2)10-11-19-16-9-6-5-8-15(16)17;2*1-2;/h4,12,15-16,18H,5-6,8-11,17H2,1-2H3;2*1-2H3;1H4/b13-4-,14-12-;;; |
| InChIKey | LXMCCNBJAAKUOR-MCEACHKBSA-N |
| XLogP | 5.76 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|