C21H33NO3 — CID 143380226
(3R)-1-[(1R)-2-[3-(4-methoxyphenyl)propoxy]cycloheptyl]pyrrolidin-3-ol (PubChem CID 143380226) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is (3R)-1-[(1R)-2-[3-(4-methoxyphenyl)propoxy]cycloheptyl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[(1R)-2-[3-(4-methoxyphenyl)propoxy]cycloheptyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 143380226 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | (3R)-1-[(1R)-2-[3-(4-methoxyphenyl)propoxy]cycloheptyl]pyrrolidin-3-ol |
| SMILES | COc1ccc(CCCOC2CCCCC[C@H]2N2CC[C@@H](O)C2)cc1 |
| InChI | InChI=1S/C21H33NO3/c1-24-19-11-9-17(10-12-19)6-5-15-25-21-8-4-2-3-7-20(21)22-14-13-18(23)16-22/h9-12,18,20-21,23H,2-8,13-16H2,1H3/t18-,20-,21?/m1/s1 |
| InChIKey | FLKQSCQIWDEWAG-SAMMEDMISA-N |
| XLogP | 3.41 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|