C25H35N3O5S — CID 143383033
2-formamido-N-[3-hydroxy-4-[(4-methoxyphenyl)sulfinyl-(2-methylbutyl)amino]-1-phenylbutan-2-yl]acetamide (PubChem CID 143383033) has the molecular formula C25H35N3O5S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-formamido-N-[3-hydroxy-4-[(4-methoxyphenyl)sulfinyl-(2-methylbutyl)amino]-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-formamido-N-[3-hydroxy-4-[(4-methoxyphenyl)sulfinyl-(2-methylbutyl)amino]-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 143383033 |
| Molecular Formula | C25H35N3O5S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-formamido-N-[3-hydroxy-4-[(4-methoxyphenyl)sulfinyl-(2-methylbutyl)amino]-1-phenylbutan-2-yl]acetamide |
| SMILES | CCC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)CNC=O)S(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H35N3O5S/c1-4-19(2)16-28(34(32)22-12-10-21(33-3)11-13-22)17-24(30)23(27-25(31)15-26-18-29)14-20-8-6-5-7-9-20/h5-13,18-19,23-24,30H,4,14-17H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | CLIONQPLDZSTHQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|