C25H35N3O6 — CID 145484338
2-formamidoethyl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 145484338) has the molecular formula C25H35N3O6 and a molecular weight of 473.57 g/mol. Its IUPAC name is 2-formamidoethyl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | 2-formamidoethyl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 145484338 |
| Molecular Formula | C25H35N3O6 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-formamidoethyl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCN(CC(O)C(Cc1ccccc1)NC(=O)OCCNC=O)Oc1cccc(OC)c1 |
| InChI | InChI=1S/C25H35N3O6/c1-3-4-14-28(34-22-12-8-11-21(17-22)32-2)18-24(30)23(16-20-9-6-5-7-10-20)27-25(31)33-15-13-26-19-29/h5-12,17,19,23-24,30H,3-4,13-16,18H2,1-2H3,(H,26,29)(H,27,31) |
| InChIKey | QSEQMBCTWXPHFG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|