C26H39N3O6 — CID 145484334
methanamine;1-oxopropan-2-yl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 145484334) has the molecular formula C26H39N3O6 and a molecular weight of 489.61 g/mol. Its IUPAC name is methanamine;1-oxopropan-2-yl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | methanamine;1-oxopropan-2-yl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 145484334 |
| Molecular Formula | C26H39N3O6 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | methanamine;1-oxopropan-2-yl N-[4-[butyl-(3-methoxyphenoxy)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | CCCCN(CC(O)C(Cc1ccccc1)NC(=O)OC(C)C=O)Oc1cccc(OC)c1.CN |
| InChI | InChI=1S/C25H34N2O6.CH5N/c1-4-5-14-27(33-22-13-9-12-21(16-22)31-3)17-24(29)23(15-20-10-7-6-8-11-20)26-25(30)32-19(2)18-28;1-2/h6-13,16,18-19,23-24,29H,4-5,14-15,17H2,1-3H3,(H,26,30);2H2,1H3 |
| InChIKey | UEKSDKQXNLHDMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|