C16H27N2O3Pb — CID 145484267
CID 145484267 (PubChem CID 145484267) has the molecular formula C16H27N2O3Pb and a molecular weight of 502.60 g/mol.
| Compound Name | CID 145484267 |
|---|---|
| PubChem CID | 145484267 |
| Molecular Formula | C16H27N2O3Pb |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | — |
| SMILES | CCCCCN(CC(O)C(N)C[Pb])Oc1cccc(OC)c1 |
| InChI | InChI=1S/C16H27N2O3.Pb/c1-4-5-6-10-18(12-16(19)13(2)17)21-15-9-7-8-14(11-15)20-3;/h7-9,11,13,16,19H,2,4-6,10,12,17H2,1,3H3; |
| InChIKey | OQABRLKFDZOARP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|