C23H34N2O3S — CID 145484327
N-[(2R,3S)-3-amino-2-methyl-4-phenylbutyl]-3-methoxy-N-pentylbenzenesulfonamide (PubChem CID 145484327) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is N-[(2R,3S)-3-amino-2-methyl-4-phenylbutyl]-3-methoxy-N-pentylbenzenesulfonamide.
| Compound Name | N-[(2R,3S)-3-amino-2-methyl-4-phenylbutyl]-3-methoxy-N-pentylbenzenesulfonamide |
|---|---|
| PubChem CID | 145484327 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-[(2R,3S)-3-amino-2-methyl-4-phenylbutyl]-3-methoxy-N-pentylbenzenesulfonamide |
| SMILES | CCCCCN(C[C@@H](C)[C@@H](N)Cc1ccccc1)S(=O)(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C23H34N2O3S/c1-4-5-9-15-25(29(26,27)22-14-10-13-21(17-22)28-3)18-19(2)23(24)16-20-11-7-6-8-12-20/h6-8,10-14,17,19,23H,4-5,9,15-16,18,24H2,1-3H3/t19-,23+/m1/s1 |
| InChIKey | UVZJYGREUJZETH-XXBNENTESA-N |
| XLogP | 4.08 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|