C23H25NO5S2 — CID 174546129
3-(benzenesulfonyl)-N-ethyl-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide (PubChem CID 174546129) has the molecular formula C23H25NO5S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-ethyl-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide.
| Compound Name | 3-(benzenesulfonyl)-N-ethyl-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174546129 |
| Molecular Formula | C23H25NO5S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 3-(benzenesulfonyl)-N-ethyl-N-[2-(3-methoxyphenyl)ethyl]benzenesulfonamide |
| SMILES | CCN(CCc1cccc(OC)c1)S(=O)(=O)c1cccc(S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO5S2/c1-3-24(16-15-19-9-7-10-20(17-19)29-2)31(27,28)23-14-8-13-22(18-23)30(25,26)21-11-5-4-6-12-21/h4-14,17-18H,3,15-16H2,1-2H3 |
| InChIKey | DEVSLYHDTZNICQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |