About morpholin-4-yl 4-aminobenzenesulfinate
morpholin-4-yl 4-aminobenzenesulfinate (PubChem CID 143384955) has the molecular formula C10H14N2O3S
and a molecular weight of 242.30 g/mol. Its IUPAC name is morpholin-4-yl 4-aminobenzenesulfinate.
Molecular Properties
| Compound Name | morpholin-4-yl 4-aminobenzenesulfinate |
| PubChem CID | 143384955 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | morpholin-4-yl 4-aminobenzenesulfinate |
| SMILES | Nc1ccc(S(=O)ON2CCOCC2)cc1 |
| InChI | InChI=1S/C10H14N2O3S/c11-9-1-3-10(4-2-9)16(13)15-12-5-7-14-8-6-12/h1-4H,5-8,11H2 |
| InChIKey | QRBMIKARFOBKJQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze morpholin-4-yl 4-aminobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-4-yl 4-aminobenzenesulfinate?
The IUPAC name of morpholin-4-yl 4-aminobenzenesulfinate (CID 143384955) is morpholin-4-yl 4-aminobenzenesulfinate.
What is the SMILES notation for morpholin-4-yl 4-aminobenzenesulfinate?
The canonical SMILES for morpholin-4-yl 4-aminobenzenesulfinate is Nc1ccc(S(=O)ON2CCOCC2)cc1.
What is the InChIKey of morpholin-4-yl 4-aminobenzenesulfinate?
The InChIKey is QRBMIKARFOBKJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3S/c11-9-1-3-10(4-2-9)16(13)15-12-5-7-14-8-6-12/h1-4H,5-8,11H2.
What are the key properties of morpholin-4-yl 4-aminobenzenesulfinate?
morpholin-4-yl 4-aminobenzenesulfinate has a molecular weight of 242.30 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-4-yl 4-aminobenzenesulfinate is sourced from PubChem (CID 143384955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).