C10H15NO2 — CID 143385204
2,4-dimethoxy-N-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 143385204) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2,4-dimethoxy-N-methylcyclohepta-1,3,6-trien-1-amine.
| Compound Name | 2,4-dimethoxy-N-methylcyclohepta-1,3,6-trien-1-amine |
|---|---|
| PubChem CID | 143385204 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2,4-dimethoxy-N-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | CNC1=C(OC)C=C(OC)CC=C1 |
| InChI | InChI=1S/C10H15NO2/c1-11-9-6-4-5-8(12-2)7-10(9)13-3/h4,6-7,11H,5H2,1-3H3 |
| InChIKey | VVROEHIEJQNDMB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |