C12H18N2 — CID 143386504
spiro[1,2,6,7-tetrahydroindole-3,4'-piperidine] (PubChem CID 143386504) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is spiro[1,2,6,7-tetrahydroindole-3,4'-piperidine].
| Compound Name | spiro[1,2,6,7-tetrahydroindole-3,4'-piperidine] |
|---|---|
| PubChem CID | 143386504 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | spiro[1,2,6,7-tetrahydroindole-3,4'-piperidine] |
| SMILES | C1=CC2=C(CC1)NCC21CCNCC1 |
| InChI | InChI=1S/C12H18N2/c1-2-4-11-10(3-1)12(9-14-11)5-7-13-8-6-12/h1,3,13-14H,2,4-9H2 |
| InChIKey | JCLXOUCOVICNGY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |