C26H39N7O4S2 — CID 143389391
acetylene;4-[[5,6-diamino-3-[(4-propan-2-ylfuran-2-yl)methylimino]pyrazin-2-ylidene]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide;2-methylpropane (PubChem CID 143389391) has the molecular formula C26H39N7O4S2 and a molecular weight of 577.78 g/mol. Its IUPAC name is acetylene;4-[[5,6-diamino-3-[(4-propan-2-ylfuran-2-yl)methylimino]pyrazin-2-ylidene]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide;2-methylpropane.
| Compound Name | acetylene;4-[[5,6-diamino-3-[(4-propan-2-ylfuran-2-yl)methylimino]pyrazin-2-ylidene]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide;2-methylpropane |
|---|---|
| PubChem CID | 143389391 |
| Molecular Formula | C26H39N7O4S2 |
| Molecular Weight | 577.78 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | acetylene;4-[[5,6-diamino-3-[(4-propan-2-ylfuran-2-yl)methylimino]pyrazin-2-ylidene]amino]-N,N-diethyl-3-hydroxythiophene-2-sulfonamide;2-methylpropane |
| SMILES | C#C.CC(C)C.CCN(CC)S(=O)(=O)c1scc(/N=C2\N=C(N)C(N)=N\C2=N/Cc2cc(C(C)C)co2)c1O |
| InChI | InChI=1S/C20H27N7O4S2.C4H10.C2H2/c1-5-27(6-2)33(29,30)20-15(28)14(10-32-20)24-19-18(25-16(21)17(22)26-19)23-8-13-7-12(9-31-13)11(3)4;1-4(2)3;1-2/h7,9-11,28H,5-6,8H2,1-4H3,(H2,21,23,25)(H2,22,24,26);4H,1-3H3;1-2H |
| InChIKey | UTQUITJDRXWRJG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 172.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|