C17H13ClN2O2 — CID 143389913
3-(6-chloropyridine-3-carbonyl)-6,7-dimethyl-1H-quinolin-4-one (PubChem CID 143389913) has the molecular formula C17H13ClN2O2 and a molecular weight of 312.76 g/mol. Its IUPAC name is 3-(6-chloropyridine-3-carbonyl)-6,7-dimethyl-1H-quinolin-4-one.
| Compound Name | 3-(6-chloropyridine-3-carbonyl)-6,7-dimethyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 143389913 |
| Molecular Formula | C17H13ClN2O2 |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-(6-chloropyridine-3-carbonyl)-6,7-dimethyl-1H-quinolin-4-one |
| SMILES | Cc1cc2[nH]cc(C(=O)c3ccc(Cl)nc3)c(=O)c2cc1C |
| InChI | InChI=1S/C17H13ClN2O2/c1-9-5-12-14(6-10(9)2)19-8-13(17(12)22)16(21)11-3-4-15(18)20-7-11/h3-8H,1-2H3,(H,19,22) |
| InChIKey | KGYCULIJKOMYBG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|