C11H10ClNO — CID 45081910
5,6-dimethyl-1H-indole-3-carbonyl chloride (PubChem CID 45081910) has the molecular formula C11H10ClNO and a molecular weight of 207.66 g/mol. Its IUPAC name is 5,6-dimethyl-1H-indole-3-carbonyl chloride.
| Compound Name | 5,6-dimethyl-1H-indole-3-carbonyl chloride |
|---|---|
| PubChem CID | 45081910 |
| Molecular Formula | C11H10ClNO |
| Molecular Weight | 207.66 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5,6-dimethyl-1H-indole-3-carbonyl chloride |
| SMILES | Cc1cc2[nH]cc(C(=O)Cl)c2cc1C |
| InChI | InChI=1S/C11H10ClNO/c1-6-3-8-9(11(12)14)5-13-10(8)4-7(6)2/h3-5,13H,1-2H3 |
| InChIKey | BIALUESMEDVWOQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.66 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|