C7H5Cl2NO2 — CID 154175166
3-methyl-1H-pyrrole-2,4-dicarbonyl chloride (PubChem CID 154175166) has the molecular formula C7H5Cl2NO2 and a molecular weight of 206.03 g/mol. Its IUPAC name is 3-methyl-1H-pyrrole-2,4-dicarbonyl chloride.
| Compound Name | 3-methyl-1H-pyrrole-2,4-dicarbonyl chloride |
|---|---|
| PubChem CID | 154175166 |
| Molecular Formula | C7H5Cl2NO2 |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | 3-methyl-1H-pyrrole-2,4-dicarbonyl chloride |
| SMILES | Cc1c(C(=O)Cl)c[nH]c1C(=O)Cl |
| InChI | InChI=1S/C7H5Cl2NO2/c1-3-4(6(8)11)2-10-5(3)7(9)12/h2,10H,1H3 |
| InChIKey | CHBCMWKEEFEOLO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|