C23H21ClFNO3 — CID 143391041
1'-[(E)-2-(4-chloro-2-methylphenyl)but-2-enoyl]-6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 143391041) has the molecular formula C23H21ClFNO3 and a molecular weight of 413.88 g/mol. Its IUPAC name is 1'-[(E)-2-(4-chloro-2-methylphenyl)but-2-enoyl]-6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 1'-[(E)-2-(4-chloro-2-methylphenyl)but-2-enoyl]-6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 143391041 |
| Molecular Formula | C23H21ClFNO3 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1'-[(E)-2-(4-chloro-2-methylphenyl)but-2-enoyl]-6-fluorospiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | C/C=C(/C(=O)N1CCC2(CC1)OC(=O)c1cc(F)ccc12)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C23H21ClFNO3/c1-3-17(18-6-4-15(24)12-14(18)2)21(27)26-10-8-23(9-11-26)20-7-5-16(25)13-19(20)22(28)29-23/h3-7,12-13H,8-11H2,1-2H3/b17-3+ |
| InChIKey | IIPDWCZBVIBNJM-IJUHEHPCSA-N |
| XLogP | 4.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|