C26H22ClFN2O5 — CID 89379489
prop-1-en-2-yl 2-[6-chloro-3-(5-fluoro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carbonyl)indol-1-yl]acetate (PubChem CID 89379489) has the molecular formula C26H22ClFN2O5 and a molecular weight of 496.92 g/mol. Its IUPAC name is prop-1-en-2-yl 2-[6-chloro-3-(5-fluoro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carbonyl)indol-1-yl]acetate.
| Compound Name | prop-1-en-2-yl 2-[6-chloro-3-(5-fluoro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carbonyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 89379489 |
| Molecular Formula | C26H22ClFN2O5 |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | prop-1-en-2-yl 2-[6-chloro-3-(5-fluoro-3-oxospiro[2-benzofuran-1,4'-piperidine]-1'-carbonyl)indol-1-yl]acetate |
| SMILES | C=C(C)OC(=O)Cn1cc(C(=O)N2CCC3(CC2)OC(=O)c2cc(F)ccc23)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C26H22ClFN2O5/c1-15(2)34-23(31)14-30-13-20(18-5-3-16(27)11-22(18)30)24(32)29-9-7-26(8-10-29)21-6-4-17(28)12-19(21)25(33)35-26/h3-6,11-13H,1,7-10,14H2,2H3 |
| InChIKey | HFZSRDGYFHWNBQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|