C9H15NO4 — CID 143391184
[(3S,4S)-4,5-dihydroxypent-1-en-3-yl]-prop-2-enylcarbamic acid (PubChem CID 143391184) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is [(3S,4S)-4,5-dihydroxypent-1-en-3-yl]-prop-2-enylcarbamic acid.
| Compound Name | [(3S,4S)-4,5-dihydroxypent-1-en-3-yl]-prop-2-enylcarbamic acid |
|---|---|
| PubChem CID | 143391184 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | [(3S,4S)-4,5-dihydroxypent-1-en-3-yl]-prop-2-enylcarbamic acid |
| SMILES | C=CCN(C(=O)O)[C@@H](C=C)[C@H](O)CO |
| InChI | InChI=1S/C9H15NO4/c1-3-5-10(9(13)14)7(4-2)8(12)6-11/h3-4,7-8,11-12H,1-2,5-6H2,(H,13,14)/t7-,8+/m0/s1 |
| InChIKey | OLNVLOGQZNVDHO-JGVFFNPUSA-N |
| XLogP | 0.06 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|