C18H17ClN4O2S — CID 143391612
4-[[4-(3,4-dimethylanilino)pyrimidin-2-yl]amino]benzenesulfonyl chloride (PubChem CID 143391612) has the molecular formula C18H17ClN4O2S and a molecular weight of 388.88 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethylanilino)pyrimidin-2-yl]amino]benzenesulfonyl chloride.
| Compound Name | 4-[[4-(3,4-dimethylanilino)pyrimidin-2-yl]amino]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 143391612 |
| Molecular Formula | C18H17ClN4O2S |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-[[4-(3,4-dimethylanilino)pyrimidin-2-yl]amino]benzenesulfonyl chloride |
| SMILES | Cc1ccc(Nc2ccnc(Nc3ccc(S(=O)(=O)Cl)cc3)n2)cc1C |
| InChI | InChI=1S/C18H17ClN4O2S/c1-12-3-4-15(11-13(12)2)21-17-9-10-20-18(23-17)22-14-5-7-16(8-6-14)26(19,24)25/h3-11H,1-2H3,(H2,20,21,22,23) |
| InChIKey | ZMFQYKQKKABCDE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |