C31H33NO — CID 143393843
1-benzyl-4-methylbenzene;2-(3-ethoxy-4-methylphenyl)-5-prop-1-en-2-ylpyridine (PubChem CID 143393843) has the molecular formula C31H33NO and a molecular weight of 435.61 g/mol. Its IUPAC name is 1-benzyl-4-methylbenzene;2-(3-ethoxy-4-methylphenyl)-5-prop-1-en-2-ylpyridine.
| Compound Name | 1-benzyl-4-methylbenzene;2-(3-ethoxy-4-methylphenyl)-5-prop-1-en-2-ylpyridine |
|---|---|
| PubChem CID | 143393843 |
| Molecular Formula | C31H33NO |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-benzyl-4-methylbenzene;2-(3-ethoxy-4-methylphenyl)-5-prop-1-en-2-ylpyridine |
| SMILES | C=C(C)c1ccc(-c2ccc(C)c(OCC)c2)nc1.Cc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO.C14H14/c1-5-19-17-10-14(7-6-13(17)4)16-9-8-15(11-18-16)12(2)3;1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13/h6-11H,2,5H2,1,3-4H3;2-10H,11H2,1H3 |
| InChIKey | LLDFIODQRXJEDZ-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |