C24H23N3OS — CID 143394314
2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanilino]-N-isoquinolin-6-ylacetamide (PubChem CID 143394314) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanilino]-N-isoquinolin-6-ylacetamide.
| Compound Name | 2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanilino]-N-isoquinolin-6-ylacetamide |
|---|---|
| PubChem CID | 143394314 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-[3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylanilino]-N-isoquinolin-6-ylacetamide |
| SMILES | C=C/C=C(\C=C/C)Sc1cccc(NCC(=O)Nc2ccc3cnccc3c2)c1 |
| InChI | InChI=1S/C24H23N3OS/c1-3-6-22(7-4-2)29-23-9-5-8-20(15-23)26-17-24(28)27-21-11-10-19-16-25-13-12-18(19)14-21/h3-16,26H,1,17H2,2H3,(H,27,28)/b7-4-,22-6+ |
| InChIKey | PCUDQQRTUUTDBM-NBGGTSLOSA-N |
| XLogP | 6.02 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|