C24H33ClN4 — CID 143395173
1-[1-[2-(2-chloro-4-methylphenyl)-3,4-dihydropyrazol-5-yl]ethenyl]-2-pentylhydrazine;toluene (PubChem CID 143395173) has the molecular formula C24H33ClN4 and a molecular weight of 413.01 g/mol. Its IUPAC name is 1-[1-[2-(2-chloro-4-methylphenyl)-3,4-dihydropyrazol-5-yl]ethenyl]-2-pentylhydrazine;toluene.
| Compound Name | 1-[1-[2-(2-chloro-4-methylphenyl)-3,4-dihydropyrazol-5-yl]ethenyl]-2-pentylhydrazine;toluene |
|---|---|
| PubChem CID | 143395173 |
| Molecular Formula | C24H33ClN4 |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[1-[2-(2-chloro-4-methylphenyl)-3,4-dihydropyrazol-5-yl]ethenyl]-2-pentylhydrazine;toluene |
| SMILES | C=C(NNCCCCC)C1=NN(c2ccc(C)cc2Cl)CC1.Cc1ccccc1 |
| InChI | InChI=1S/C17H25ClN4.C7H8/c1-4-5-6-10-19-20-14(3)16-9-11-22(21-16)17-8-7-13(2)12-15(17)18;1-7-5-3-2-4-6-7/h7-8,12,19-20H,3-6,9-11H2,1-2H3;2-6H,1H3 |
| InChIKey | QGCZMOOPZNTWSF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|