C15H20Cl2N4O — CID 143395196
2-(2,4-dichlorophenyl)-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide (PubChem CID 143395196) has the molecular formula C15H20Cl2N4O and a molecular weight of 343.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide.
| Compound Name | 2-(2,4-dichlorophenyl)-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 143395196 |
| Molecular Formula | C15H20Cl2N4O |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N'-pentyl-3,4-dihydropyrazole-5-carbohydrazide |
| SMILES | CCCCCNNC(=O)C1=NN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H20Cl2N4O/c1-2-3-4-8-18-19-15(22)13-7-9-21(20-13)14-6-5-11(16)10-12(14)17/h5-6,10,18H,2-4,7-9H2,1H3,(H,19,22) |
| InChIKey | UMMRVPRRSQPFPI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|