C22H32N2 — CID 143398967
1-[3-[(1R)-2-cyclohexa-2,4-dien-1-yl-1-(cyclohexen-1-yl)ethyl]cyclopentyl]-4,5-dihydroimidazole (PubChem CID 143398967) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-[3-[(1R)-2-cyclohexa-2,4-dien-1-yl-1-(cyclohexen-1-yl)ethyl]cyclopentyl]-4,5-dihydroimidazole.
| Compound Name | 1-[3-[(1R)-2-cyclohexa-2,4-dien-1-yl-1-(cyclohexen-1-yl)ethyl]cyclopentyl]-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 143398967 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-[3-[(1R)-2-cyclohexa-2,4-dien-1-yl-1-(cyclohexen-1-yl)ethyl]cyclopentyl]-4,5-dihydroimidazole |
| SMILES | C1=CCC(C[C@@H](C2=CCCCC2)C2CCC(N3C=NCC3)C2)C=C1 |
| InChI | InChI=1S/C22H32N2/c1-3-7-18(8-4-1)15-22(19-9-5-2-6-10-19)20-11-12-21(16-20)24-14-13-23-17-24/h1,3-4,7,9,17-18,20-22H,2,5-6,8,10-16H2/t18?,20?,21?,22-/m0/s1 |
| InChIKey | ZWQYDUONGGBIAG-OUHCFLCTSA-N |
| XLogP | 5.14 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|