C23H37N2+ — CID 123533546
1-(4-tert-butylcyclohexa-1,3-dien-1-yl)-3-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dihydroimidazol-3-ium (PubChem CID 123533546) has the molecular formula C23H37N2+ and a molecular weight of 341.56 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)-3-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dihydroimidazol-3-ium.
| Compound Name | 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)-3-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 123533546 |
| Molecular Formula | C23H37N2+ |
| Molecular Weight | 341.56 g/mol |
| Exact Mass | 341.30 |
| IUPAC Name | 1-(4-tert-butylcyclohexa-1,3-dien-1-yl)-3-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dihydroimidazol-3-ium |
| SMILES | CC(C)(C)C1=CC=C(N2C=[N+]([C@H]3C=C[C@@H](C(C)(C)C)CC3)CC2)CC1 |
| InChI | InChI=1S/C23H37N2/c1-22(2,3)18-7-11-20(12-8-18)24-15-16-25(17-24)21-13-9-19(10-14-21)23(4,5)6/h7,9,11,13,17-18,20H,8,10,12,14-16H2,1-6H3/q+1/t18-,20+/m1/s1 |
| InChIKey | VIAYCSJAISNNAL-QUCCMNQESA-N |
| XLogP | 5.37 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|