C29H42N2 — CID 171538734
(4E,5E)-1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-ethylidene-5-prop-2-enylideneimidazole;ethane (PubChem CID 171538734) has the molecular formula C29H42N2 and a molecular weight of 418.67 g/mol. Its IUPAC name is (4E,5E)-1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-ethylidene-5-prop-2-enylideneimidazole;ethane.
| Compound Name | (4E,5E)-1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-ethylidene-5-prop-2-enylideneimidazole;ethane |
|---|---|
| PubChem CID | 171538734 |
| Molecular Formula | C29H42N2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (4E,5E)-1-(10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-ethylidene-5-prop-2-enylideneimidazole;ethane |
| SMILES | C=C/C=c1\c(=C/C)ncn1C1=CCC2C3CC=C4CCCCC4(C)C3CCC12C.CC |
| InChI | InChI=1S/C27H36N2.C2H6/c1-5-9-24-23(6-2)28-18-29(24)25-14-13-21-20-12-11-19-10-7-8-16-26(19,3)22(20)15-17-27(21,25)4;1-2/h5-6,9,11,14,18,20-22H,1,7-8,10,12-13,15-17H2,2-4H3;1-2H3/b23-6+,24-9+; |
| InChIKey | WYERTSLQRCYTAR-VSLANOSZSA-N |
| XLogP | 6.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|