C27H36N2 — CID 123676105
4-methylidene-5-prop-2-enylidene-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)imidazole (PubChem CID 123676105) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 4-methylidene-5-prop-2-enylidene-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)imidazole.
| Compound Name | 4-methylidene-5-prop-2-enylidene-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)imidazole |
|---|---|
| PubChem CID | 123676105 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | 4-methylidene-5-prop-2-enylidene-1-(3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)imidazole |
| SMILES | C=CC=c1c(=C)ncn1C1C=CC2C3CC=C4CC(C)CCC4(C)C3CCC21C |
| InChI | InChI=1S/C27H36N2/c1-6-7-24-19(3)28-17-29(24)25-11-10-22-21-9-8-20-16-18(2)12-14-26(20,4)23(21)13-15-27(22,25)5/h6-8,10-11,17-18,21-23,25H,1,3,9,12-16H2,2,4-5H3 |
| InChIKey | YLRJMKARIPCYQC-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|