C11H17FN2 — CID 143401046
1-(cyclohexa-1,5-dien-1-ylmethyl)-4-fluoropiperazine (PubChem CID 143401046) has the molecular formula C11H17FN2 and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-fluoropiperazine.
| Compound Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-fluoropiperazine |
|---|---|
| PubChem CID | 143401046 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-(cyclohexa-1,5-dien-1-ylmethyl)-4-fluoropiperazine |
| SMILES | FN1CCN(CC2=CCCC=C2)CC1 |
| InChI | InChI=1S/C11H17FN2/c12-14-8-6-13(7-9-14)10-11-4-2-1-3-5-11/h2,4-5H,1,3,6-10H2 |
| InChIKey | HQSOQPGUNAFEFM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|