C12H18F2N2 — CID 166462619
1-[(3Z)-3,4-difluoro-2-methylidenehexa-3,5-dienyl]-4-methylpiperazine (PubChem CID 166462619) has the molecular formula C12H18F2N2 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-[(3Z)-3,4-difluoro-2-methylidenehexa-3,5-dienyl]-4-methylpiperazine.
| Compound Name | 1-[(3Z)-3,4-difluoro-2-methylidenehexa-3,5-dienyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 166462619 |
| Molecular Formula | C12H18F2N2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-[(3Z)-3,4-difluoro-2-methylidenehexa-3,5-dienyl]-4-methylpiperazine |
| SMILES | C=C/C(F)=C(/F)C(=C)CN1CCN(C)CC1 |
| InChI | InChI=1S/C12H18F2N2/c1-4-11(13)12(14)10(2)9-16-7-5-15(3)6-8-16/h4H,1-2,5-9H2,3H3/b12-11- |
| InChIKey | FFRIEJAKCABKAF-QXMHVHEDSA-N |
| XLogP | 2.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|