C17H32ClN — CID 143401352
ethane;3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl chloride (PubChem CID 143401352) has the molecular formula C17H32ClN and a molecular weight of 285.90 g/mol. Its IUPAC name is ethane;3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl chloride.
| Compound Name | ethane;3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl chloride |
|---|---|
| PubChem CID | 143401352 |
| Molecular Formula | C17H32ClN |
| Molecular Weight | 285.90 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | ethane;3-ethenyl-N-methyl-2-[(Z)-prop-1-enyl]penta-2,4-dienimidoyl chloride |
| SMILES | C=CC(C=C)=C(/C=C\C)/C(Cl)=N/C.CC.CC.CC |
| InChI | InChI=1S/C11H14ClN.3C2H6/c1-5-8-10(11(12)13-4)9(6-2)7-3;3*1-2/h5-8H,2-3H2,1,4H3;3*1-2H3/b8-5-,13-11-;;; |
| InChIKey | VCXSCGHTJLHJBX-DUCKYGGESA-N |
| XLogP | 6.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.90 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|