C17H26ClN — CID 155728858
(E,2E)-2-[(Z)-but-2-enylidene]-3-methyl-N-[(E)-pent-1-enyl]hept-3-enimidoyl chloride (PubChem CID 155728858) has the molecular formula C17H26ClN and a molecular weight of 279.85 g/mol. Its IUPAC name is (E,2E)-2-[(Z)-but-2-enylidene]-3-methyl-N-[(E)-pent-1-enyl]hept-3-enimidoyl chloride.
| Compound Name | (E,2E)-2-[(Z)-but-2-enylidene]-3-methyl-N-[(E)-pent-1-enyl]hept-3-enimidoyl chloride |
|---|---|
| PubChem CID | 155728858 |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.85 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | (E,2E)-2-[(Z)-but-2-enylidene]-3-methyl-N-[(E)-pent-1-enyl]hept-3-enimidoyl chloride |
| SMILES | C/C=C\C=C(C(\Cl)=N\C=C\CCC)/C(C)=C/CCC |
| InChI | InChI=1S/C17H26ClN/c1-5-8-11-14-19-17(18)16(13-10-7-3)15(4)12-9-6-2/h7,10-14H,5-6,8-9H2,1-4H3/b10-7-,14-11+,15-12+,16-13+,19-17- |
| InChIKey | LLEACVCTSPWTFR-MSGKCQHLSA-N |
| XLogP | 6.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.85 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|