C22H39N3 — CID 143401395
ethane;4-ethenyl-2-methyl-3-[(Z)-prop-1-enyl]-6-(1H-pyrazol-5-yl)pyridine (PubChem CID 143401395) has the molecular formula C22H39N3 and a molecular weight of 345.58 g/mol. Its IUPAC name is ethane;4-ethenyl-2-methyl-3-[(Z)-prop-1-enyl]-6-(1H-pyrazol-5-yl)pyridine.
| Compound Name | ethane;4-ethenyl-2-methyl-3-[(Z)-prop-1-enyl]-6-(1H-pyrazol-5-yl)pyridine |
|---|---|
| PubChem CID | 143401395 |
| Molecular Formula | C22H39N3 |
| Molecular Weight | 345.58 g/mol |
| Exact Mass | 345.31 |
| IUPAC Name | ethane;4-ethenyl-2-methyl-3-[(Z)-prop-1-enyl]-6-(1H-pyrazol-5-yl)pyridine |
| SMILES | C=Cc1cc(-c2ccn[nH]2)nc(C)c1/C=C\C.CC.CC.CC.CC |
| InChI | InChI=1S/C14H15N3.4C2H6/c1-4-6-12-10(3)16-14(9-11(12)5-2)13-7-8-15-17-13;4*1-2/h4-9H,2H2,1,3H3,(H,15,17);4*1-2H3/b6-4-;;;; |
| InChIKey | HHQBMJMHTVGFNK-RGYKDBBASA-N |
| XLogP | 7.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.58 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |