C27H41FN4O5 — CID 143402728
[(3R,5S)-5-carbamoyl-1-[(2S)-2-[(2-methylpropan-2-yl)oxymethylamino]octanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 143402728) has the molecular formula C27H41FN4O5 and a molecular weight of 520.65 g/mol. Its IUPAC name is [(3R,5S)-5-carbamoyl-1-[(2S)-2-[(2-methylpropan-2-yl)oxymethylamino]octanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(3R,5S)-5-carbamoyl-1-[(2S)-2-[(2-methylpropan-2-yl)oxymethylamino]octanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 143402728 |
| Molecular Formula | C27H41FN4O5 |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | [(3R,5S)-5-carbamoyl-1-[(2S)-2-[(2-methylpropan-2-yl)oxymethylamino]octanoyl]pyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | CCCCCC[C@H](NCOC(C)(C)C)C(=O)N1C[C@H](OC(=O)N2Cc3cccc(F)c3C2)C[C@H]1C(N)=O |
| InChI | InChI=1S/C27H41FN4O5/c1-5-6-7-8-12-22(30-17-36-27(2,3)4)25(34)32-15-19(13-23(32)24(29)33)37-26(35)31-14-18-10-9-11-21(28)20(18)16-31/h9-11,19,22-23,30H,5-8,12-17H2,1-4H3,(H2,29,33)/t19-,22+,23+/m1/s1 |
| InChIKey | IGWWGEJFPXTFIJ-OIBXWCBGSA-N |
| XLogP | 3.43 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|