C22H26FN3O6 — CID 143826779
[(5S)-1-[(3R)-3-[(E)-but-2-enoyl]oxybutanoyl]-5-carbamoylpyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 143826779) has the molecular formula C22H26FN3O6 and a molecular weight of 447.46 g/mol. Its IUPAC name is [(5S)-1-[(3R)-3-[(E)-but-2-enoyl]oxybutanoyl]-5-carbamoylpyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | [(5S)-1-[(3R)-3-[(E)-but-2-enoyl]oxybutanoyl]-5-carbamoylpyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 143826779 |
| Molecular Formula | C22H26FN3O6 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | [(5S)-1-[(3R)-3-[(E)-but-2-enoyl]oxybutanoyl]-5-carbamoylpyrrolidin-3-yl] 4-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C/C=C/C(=O)O[C@H](C)CC(=O)N1CC(OC(=O)N2Cc3cccc(F)c3C2)C[C@H]1C(N)=O |
| InChI | InChI=1S/C22H26FN3O6/c1-3-5-20(28)31-13(2)8-19(27)26-11-15(9-18(26)21(24)29)32-22(30)25-10-14-6-4-7-17(23)16(14)12-25/h3-7,13,15,18H,8-12H2,1-2H3,(H2,24,29)/b5-3+/t13-,15?,18+/m1/s1 |
| InChIKey | SVSJJHHBWGWFKV-BWVRENIJSA-N |
| XLogP | 1.63 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|