C32H50BrN3O6 — CID 143403942
ethane;ethyl 1-[(2S)-2-[[5-bromo-5-(5-methyl-1-oxo-2H-isoquinolin-7-yl)pentoxy]carbonylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylate (PubChem CID 143403942) has the molecular formula C32H50BrN3O6 and a molecular weight of 652.67 g/mol. Its IUPAC name is ethane;ethyl 1-[(2S)-2-[[5-bromo-5-(5-methyl-1-oxo-2H-isoquinolin-7-yl)pentoxy]carbonylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylate.
| Compound Name | ethane;ethyl 1-[(2S)-2-[[5-bromo-5-(5-methyl-1-oxo-2H-isoquinolin-7-yl)pentoxy]carbonylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 143403942 |
| Molecular Formula | C32H50BrN3O6 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 651.29 |
| IUPAC Name | ethane;ethyl 1-[(2S)-2-[[5-bromo-5-(5-methyl-1-oxo-2H-isoquinolin-7-yl)pentoxy]carbonylamino]-3-methylbutanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC.CC.CCOC(=O)C1CCCN1C(=O)[C@@H](NC(=O)OCCCCC(Br)c1cc(C)c2cc[nH]c(=O)c2c1)C(C)C |
| InChI | InChI=1S/C28H38BrN3O6.2C2H6/c1-5-37-27(35)23-10-8-13-32(23)26(34)24(17(2)3)31-28(36)38-14-7-6-9-22(29)19-15-18(4)20-11-12-30-25(33)21(20)16-19;2*1-2/h11-12,15-17,22-24H,5-10,13-14H2,1-4H3,(H,30,33)(H,31,36);2*1-2H3/t22?,23?,24-;;/m0../s1 |
| InChIKey | WOCUSTPBLZUAED-UOLJINHCSA-N |
| XLogP | 6.80 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|