C30H23NO3 — CID 14340492
1-[2-[[(1S)-1-phenylethyl]carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid (PubChem CID 14340492) has the molecular formula C30H23NO3 and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-[2-[[(1S)-1-phenylethyl]carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid.
| Compound Name | 1-[2-[[(1S)-1-phenylethyl]carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 14340492 |
| Molecular Formula | C30H23NO3 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 1-[2-[[(1S)-1-phenylethyl]carbamoyl]naphthalen-1-yl]naphthalene-2-carboxylic acid |
| SMILES | C[C@H](NC(=O)c1ccc2ccccc2c1-c1c(C(=O)O)ccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C30H23NO3/c1-19(20-9-3-2-4-10-20)31-29(32)25-17-15-21-11-5-7-13-23(21)27(25)28-24-14-8-6-12-22(24)16-18-26(28)30(33)34/h2-19H,1H3,(H,31,32)(H,33,34)/t19-/m0/s1 |
| InChIKey | PLBYNFJAUJHIAR-IBGZPJMESA-N |
| XLogP | 6.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |