C18H22N2O2 — CID 143405821
ethane;2-methyl-5-[3-(methylcarbamoyl)phenyl]benzamide (PubChem CID 143405821) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is ethane;2-methyl-5-[3-(methylcarbamoyl)phenyl]benzamide.
| Compound Name | ethane;2-methyl-5-[3-(methylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 143405821 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | ethane;2-methyl-5-[3-(methylcarbamoyl)phenyl]benzamide |
| SMILES | CC.CNC(=O)c1cccc(-c2ccc(C)c(C(N)=O)c2)c1 |
| InChI | InChI=1S/C16H16N2O2.C2H6/c1-10-6-7-12(9-14(10)15(17)19)11-4-3-5-13(8-11)16(20)18-2;1-2/h3-9H,1-2H3,(H2,17,19)(H,18,20);1-2H3 |
| InChIKey | KMVZBRCCJWLLBP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |