C16H19N3O2 — CID 161133273
3-amino-N-methylbenzamide;2-methylbenzamide (PubChem CID 161133273) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-amino-N-methylbenzamide;2-methylbenzamide.
| Compound Name | 3-amino-N-methylbenzamide;2-methylbenzamide |
|---|---|
| PubChem CID | 161133273 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-amino-N-methylbenzamide;2-methylbenzamide |
| SMILES | CNC(=O)c1cccc(N)c1.Cc1ccccc1C(N)=O |
| InChI | InChI=1S/C8H10N2O.C8H9NO/c1-10-8(11)6-3-2-4-7(9)5-6;1-6-4-2-3-5-7(6)8(9)10/h2-5H,9H2,1H3,(H,10,11);2-5H,1H3,(H2,9,10) |
| InChIKey | UMLYZZKMEIMQLG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|