C18H22N2O3S — CID 143407635
N,N-dimethylmethanamine;N-(3-methoxyphenyl)-5-prop-2-enoylthiophene-2-carboxamide (PubChem CID 143407635) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N,N-dimethylmethanamine;N-(3-methoxyphenyl)-5-prop-2-enoylthiophene-2-carboxamide.
| Compound Name | N,N-dimethylmethanamine;N-(3-methoxyphenyl)-5-prop-2-enoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 143407635 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N,N-dimethylmethanamine;N-(3-methoxyphenyl)-5-prop-2-enoylthiophene-2-carboxamide |
| SMILES | C=CC(=O)c1ccc(C(=O)Nc2cccc(OC)c2)s1.CN(C)C |
| InChI | InChI=1S/C15H13NO3S.C3H9N/c1-3-12(17)13-7-8-14(20-13)15(18)16-10-5-4-6-11(9-10)19-2;1-4(2)3/h3-9H,1H2,2H3,(H,16,18);1-3H3 |
| InChIKey | ALWSQDGUWNOPMM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|