About methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate
methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate (PubChem CID 143410712) has the molecular formula C18H31N3O4
and a molecular weight of 353.46 g/mol. Its IUPAC name is methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate.
Molecular Properties
| Compound Name | methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate |
| PubChem CID | 143410712 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate |
| SMILES | C.O=C(OCCN1CCCC1=O)C(=O)N1CCC(C2CCNC2)CC1 |
| InChI | InChI=1S/C17H27N3O4.CH4/c21-15-2-1-7-19(15)10-11-24-17(23)16(22)20-8-4-13(5-9-20)14-3-6-18-12-14;/h13-14,18H,1-12H2;1H4 |
| InChIKey | YQBWVLQZWKSUCG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate?
The IUPAC name of methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate (CID 143410712) is methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate.
What is the SMILES notation for methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate?
The canonical SMILES for methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate is C.O=C(OCCN1CCCC1=O)C(=O)N1CCC(C2CCNC2)CC1.
What is the InChIKey of methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate?
The InChIKey is YQBWVLQZWKSUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3O4.CH4/c21-15-2-1-7-19(15)10-11-24-17(23)16(22)20-8-4-13(5-9-20)14-3-6-18-12-14;/h13-14,18H,1-12H2;1H4.
What are the key properties of methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate?
methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate has a molecular weight of 353.46 g/mol, XLogP of 0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-(2-oxopyrrolidin-1-yl)ethyl 2-oxo-2-(4-pyrrolidin-3-ylpiperidin-1-yl)acetate is sourced from PubChem (CID 143410712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).