C23H20N4O4S — CID 143411250
3-methoxy-5-methyl-2-[(13Z,15Z)-2-oxo-11-oxa-2λ4-thia-9-azatricyclo[8.7.0.03,8]heptadeca-1(10),3,5,7,13,15-hexaen-9-yl]benzoyl azide (PubChem CID 143411250) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-methoxy-5-methyl-2-[(13Z,15Z)-2-oxo-11-oxa-2λ4-thia-9-azatricyclo[8.7.0.03,8]heptadeca-1(10),3,5,7,13,15-hexaen-9-yl]benzoyl azide.
| Compound Name | 3-methoxy-5-methyl-2-[(13Z,15Z)-2-oxo-11-oxa-2λ4-thia-9-azatricyclo[8.7.0.03,8]heptadeca-1(10),3,5,7,13,15-hexaen-9-yl]benzoyl azide |
|---|---|
| PubChem CID | 143411250 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-methoxy-5-methyl-2-[(13Z,15Z)-2-oxo-11-oxa-2λ4-thia-9-azatricyclo[8.7.0.03,8]heptadeca-1(10),3,5,7,13,15-hexaen-9-yl]benzoyl azide |
| SMILES | COc1cc(C)cc(C(=O)N=[N+]=[N-])c1N1C2=C(C/C=C\C=C/CO2)S(=O)c2ccccc21 |
| InChI | InChI=1S/C23H20N4O4S/c1-15-13-16(22(28)25-26-24)21(18(14-15)30-2)27-17-9-6-7-10-19(17)32(29)20-11-5-3-4-8-12-31-23(20)27/h3-10,13-14H,11-12H2,1-2H3/b5-3-,8-4- |
| InChIKey | HKMSGHQNZGXEMU-ZWWVTPAXSA-N |
| XLogP | 5.42 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|